CAS 2197044-65-6 appears in our catalog under these names: (5R)-5-(4-Bromo-benzyl)-l-pipecolinic acid hydrochloride, 95%, (2S,5R)-5-(4-Bromobenzyl)piperidine-2-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
(2S,5R)-5-[(4-bromophenyl)methyl]piperidine-2-carboxylic acid;hydrochloride (CAS 2197044-65-6) is a chemical compound with the molecular formula C13H17BrClNO2 and a molecular weight of 334.63 g/mol. IUPAC name: (2S,5R)-5-[(4-bromophenyl)methyl]piperidine-2-carboxylic acid;hydrochloride. InChIKey: PPXIGFPGRYSDGJ-IYJPBCIQSA-N.
| Molecular formula | C13H17BrClNO2 |
|---|---|
| Molecular weight | 334.63 g/mol |
| IUPAC name | (2S,5R)-5-[(4-bromophenyl)methyl]piperidine-2-carboxylic acid;hydrochloride |
| InChIKey | PPXIGFPGRYSDGJ-IYJPBCIQSA-N |
| SMILES | C1C[C@H](NC[C@H]1CC2=CC=C(C=C2)Br)C(=O)O.Cl |
Computed by PubChem (NCBI)