CAS 1799439-22-7 appears in our catalog under these names: trans-Cyclopentane-1,3-diamine dihydrochloride, 98%, 98%, trans-Cyclopentane-1,3-diamine dihydrochloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 500mg.
Trans-(1R,3R)-cyclopentane-1,3-diamine;dihydrochloride (CAS 1799439-22-7) is a chemical compound with the molecular formula C5H14Cl2N2 and a molecular weight of 173.08 g/mol. IUPAC name: trans-(1R,3R)-cyclopentane-1,3-diamine;dihydrochloride. InChIKey: UQEZIVFRVHUPSU-ALUAXPQUSA-N.
| Molecular formula | C5H14Cl2N2 |
|---|---|
| Molecular weight | 173.08 g/mol |
| IUPAC name | trans-(1R,3R)-cyclopentane-1,3-diamine;dihydrochloride |
| InChIKey | UQEZIVFRVHUPSU-ALUAXPQUSA-N |
| SMILES | C1C[C@H](C[C@@H]1N)N.Cl.Cl |
Computed by PubChem (NCBI)