Products 2725774-24-1

CAS 2725774-24-1 is the registry number for (1S,3S)-cyclopentane-1,3-diamine,dihydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

Trans-(1S,3S)-cyclopentane-1,3-diamine;dihydrochloride (CAS 2725774-24-1) is a chemical compound with the molecular formula C5H14Cl2N2 and a molecular weight of 173.08 g/mol. IUPAC name: trans-(1S,3S)-cyclopentane-1,3-diamine;dihydrochloride. InChIKey: UQEZIVFRVHUPSU-RSLHMRQOSA-N.

Identity
Molecular formulaC5H14Cl2N2
Molecular weight173.08 g/mol
IUPAC nametrans-(1S,3S)-cyclopentane-1,3-diamine;dihydrochloride
InChIKeyUQEZIVFRVHUPSU-RSLHMRQOSA-N
SMILESC1C[C@@H](C[C@H]1N)N.Cl.Cl

Computed by PubChem (NCBI)