CAS 2725774-24-1 is the registry number for (1S,3S)-cyclopentane-1,3-diamine,dihydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
Trans-(1S,3S)-cyclopentane-1,3-diamine;dihydrochloride (CAS 2725774-24-1) is a chemical compound with the molecular formula C5H14Cl2N2 and a molecular weight of 173.08 g/mol. IUPAC name: trans-(1S,3S)-cyclopentane-1,3-diamine;dihydrochloride. InChIKey: UQEZIVFRVHUPSU-RSLHMRQOSA-N.
| Molecular formula | C5H14Cl2N2 |
|---|---|
| Molecular weight | 173.08 g/mol |
| IUPAC name | trans-(1S,3S)-cyclopentane-1,3-diamine;dihydrochloride |
| InChIKey | UQEZIVFRVHUPSU-RSLHMRQOSA-N |
| SMILES | C1C[C@@H](C[C@H]1N)N.Cl.Cl |
Computed by PubChem (NCBI)