CAS 179990-59-1 is the registry number for (4R, 2S)-4-Hydroxy-1-(9-phenyl-9H-fluoren-9-yl)-proline Methyl Ester, >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5g, 250mg.
Methyl (2S,4R)-4-hydroxy-1-(9-phenylfluoren-9-yl)pyrrolidine-2-carboxylate (CAS 179990-59-1) is a chemical compound with the molecular formula C25H23NO3 and a molecular weight of 385.5 g/mol. IUPAC name: methyl (2S,4R)-4-hydroxy-1-(9-phenylfluoren-9-yl)pyrrolidine-2-carboxylate. InChIKey: MJIVTEQYUJILHQ-JPYJTQIMSA-N.
| Molecular formula | C25H23NO3 |
|---|---|
| Molecular weight | 385.5 g/mol |
| IUPAC name | methyl (2S,4R)-4-hydroxy-1-(9-phenylfluoren-9-yl)pyrrolidine-2-carboxylate |
| InChIKey | MJIVTEQYUJILHQ-JPYJTQIMSA-N |
| SMILES | COC(=O)[C@@H]1C[C@H](CN1C2(C3=CC=CC=C3C4=CC=CC=C42)C5=CC=CC=C5)O |
Computed by PubChem (NCBI)