Products 2748469-43-2
CAS 2748469-43-2 is the registry number for MAM2201 N–pentanoic acid metabolite–d5. Offered by: GLPBio. Available pack sizes: 1mg, 100μg, 500μg.
5-[2,4,5,6,7-pentadeuterio-3-(4-methylnaphthalene-1-carbonyl)indol-1-yl]pentanoic acid (CAS 2748469-43-2) is a chemical compound with the molecular formula C25H23NO3 and a molecular weight of 390.5 g/mol. IUPAC name: 5-[2,4,5,6,7-pentadeuterio-3-(4-methylnaphthalene-1-carbonyl)indol-1-yl]pentanoic acid. InChIKey: CXHVTSVFMMQERU-CGSQFYLRSA-N.
| Molecular formula | C25H23NO3 |
|---|---|
| Molecular weight | 390.5 g/mol |
| IUPAC name | 5-[2,4,5,6,7-pentadeuterio-3-(4-methylnaphthalene-1-carbonyl)indol-1-yl]pentanoic acid |
| InChIKey | CXHVTSVFMMQERU-CGSQFYLRSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(N2CCCCC(=O)O)[2H])C(=O)C3=CC=C(C4=CC=CC=C43)C)[2H])[2H] |
Computed by PubChem (NCBI)