CAS 1799974-18-7 is the registry number for (S)-4-Methyl-3,4-dihydro-2H-benzo[b][1,4,5]oxathiazepine 1,1-dioxide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(4S)-4-methyl-3,4-dihydro-2H-5,1lambda6,2-benzoxathiazepine 1,1-dioxide (CAS 1799974-18-7) is a chemical compound with the molecular formula C9H11NO3S and a molecular weight of 213.26 g/mol. IUPAC name: (4S)-4-methyl-3,4-dihydro-2H-5,1lambda6,2-benzoxathiazepine 1,1-dioxide. InChIKey: DSDAZNIRFKEUHN-ZETCQYMHSA-N.
| Molecular formula | C9H11NO3S |
|---|---|
| Molecular weight | 213.26 g/mol |
| IUPAC name | (4S)-4-methyl-3,4-dihydro-2H-5,1lambda6,2-benzoxathiazepine 1,1-dioxide |
| InChIKey | DSDAZNIRFKEUHN-ZETCQYMHSA-N |
| SMILES | C[C@H]1CNS(=O)(=O)C2=CC=CC=C2O1 |
Computed by PubChem (NCBI)