CAS 1800305-86-5 is the registry number for 5-Fluoro-1-hydroxy-1,3-dihydrobenzo(c)(1,2)oxaborole-6-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 250mg, 100mg.
5-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carboxylic acid (CAS 1800305-86-5) is a chemical compound with the molecular formula C8H6BFO4 and a molecular weight of 195.94 g/mol. IUPAC name: 5-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carboxylic acid. InChIKey: XNTKXXOTDXHIKP-UHFFFAOYSA-N.
| Molecular formula | C8H6BFO4 |
|---|---|
| Molecular weight | 195.94 g/mol |
| IUPAC name | 5-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carboxylic acid |
| InChIKey | XNTKXXOTDXHIKP-UHFFFAOYSA-N |
| SMILES | B1(C2=CC(=C(C=C2CO1)F)C(=O)O)O |
Computed by PubChem (NCBI)