Products 1800305-86-5

CAS 1800305-86-5 is the registry number for 5-Fluoro-1-hydroxy-1,3-dihydrobenzo(c)(1,2)oxaborole-6-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 250mg, 100mg.

Structural formula: {0} (CAS {1})

5-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carboxylic acid (CAS 1800305-86-5) is a chemical compound with the molecular formula C8H6BFO4 and a molecular weight of 195.94 g/mol. IUPAC name: 5-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carboxylic acid. InChIKey: XNTKXXOTDXHIKP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6BFO4
Molecular weight195.94 g/mol
IUPAC name5-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carboxylic acid
InChIKeyXNTKXXOTDXHIKP-UHFFFAOYSA-N
SMILESB1(C2=CC(=C(C=C2CO1)F)C(=O)O)O

Computed by PubChem (NCBI)