CAS 870778-85-1 is the registry number for 2-Fluoro-3,5-diformylphenylboronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2-fluoro-3,5-diformylphenyl)boronic acid (CAS 870778-85-1) is a chemical compound with the molecular formula C8H6BFO4 and a molecular weight of 195.94 g/mol. IUPAC name: (2-fluoro-3,5-diformylphenyl)boronic acid. InChIKey: KKXARFPYUGQNNK-UHFFFAOYSA-N.
| Molecular formula | C8H6BFO4 |
|---|---|
| Molecular weight | 195.94 g/mol |
| IUPAC name | (2-fluoro-3,5-diformylphenyl)boronic acid |
| InChIKey | KKXARFPYUGQNNK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1F)C=O)C=O)(O)O |
Computed by PubChem (NCBI)