CAS 1800386-92-8 appears in our catalog under these names: Indolo[2,3-a]carbazole, 11,12-bis([1,1'-biphenyl]-4-yl)-11,12-dihydro-, 95%, 11,12-Bis([1,1′-biphenyl]-4-yl)-11,12-dihydroindolo[2,3-a]carbazole, 98%, 98%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
11,12-bis(4-phenylphenyl)indolo[2,3-a]carbazole (CAS 1800386-92-8) is a chemical compound with the molecular formula C42H28N2 and a molecular weight of 560.7 g/mol. IUPAC name: 11,12-bis(4-phenylphenyl)indolo[2,3-a]carbazole. InChIKey: NEJWLEAAVKCZLJ-UHFFFAOYSA-N.
| Molecular formula | C42H28N2 |
|---|---|
| Molecular weight | 560.7 g/mol |
| IUPAC name | 11,12-bis(4-phenylphenyl)indolo[2,3-a]carbazole |
| InChIKey | NEJWLEAAVKCZLJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)N3C4=CC=CC=C4C5=C3C6=C(C=C5)C7=CC=CC=C7N6C8=CC=C(C=C8)C9=CC=CC=C9 |
Computed by PubChem (NCBI)