CAS 221544-74-7 is the registry number for Indolo[3,2-b]carbazole, 5,11-bis([1,1'-biphenyl]-4-yl)-5,11-dihydro-, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5,11-bis(4-phenylphenyl)indolo[3,2-b]carbazole (CAS 221544-74-7) is a chemical compound with the molecular formula C42H28N2 and a molecular weight of 560.7 g/mol. IUPAC name: 5,11-bis(4-phenylphenyl)indolo[3,2-b]carbazole. InChIKey: YTRXKRWAYQPNED-UHFFFAOYSA-N.
| Molecular formula | C42H28N2 |
|---|---|
| Molecular weight | 560.7 g/mol |
| IUPAC name | 5,11-bis(4-phenylphenyl)indolo[3,2-b]carbazole |
| InChIKey | YTRXKRWAYQPNED-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)N3C4=CC=CC=C4C5=CC6=C(C=C53)C7=CC=CC=C7N6C8=CC=C(C=C8)C9=CC=CC=C9 |
Computed by PubChem (NCBI)