CAS 180091-38-7 appears in our catalog under these names: 2,2,3,3-Tetrafluoro-1,4-benzodioxane-6-carboxylic acid, 95%, 2,2,3,3-Tetrafluoro-1,4-benzodioxane-6-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
2,2,3,3-tetrafluoro-1,4-benzodioxine-6-carboxylic acid (CAS 180091-38-7) is a chemical compound with the molecular formula C9H4F4O4 and a molecular weight of 252.12 g/mol. IUPAC name: 2,2,3,3-tetrafluoro-1,4-benzodioxine-6-carboxylic acid. InChIKey: BSLPWYNSRXMUTK-UHFFFAOYSA-N.
| Molecular formula | C9H4F4O4 |
|---|---|
| Molecular weight | 252.12 g/mol |
| IUPAC name | 2,2,3,3-tetrafluoro-1,4-benzodioxine-6-carboxylic acid |
| InChIKey | BSLPWYNSRXMUTK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)OC(C(O2)(F)F)(F)F |
Computed by PubChem (NCBI)