Products 83789-90-6

CAS 83789-90-6 is the registry number for 4-Acetoxy-2,3,5,6-tetrafluorobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.

Structural formula: {0} (CAS {1})

4-acetyloxy-2,3,5,6-tetrafluorobenzoic acid (CAS 83789-90-6) is a chemical compound with the molecular formula C9H4F4O4 and a molecular weight of 252.12 g/mol. IUPAC name: 4-acetyloxy-2,3,5,6-tetrafluorobenzoic acid. InChIKey: WIGOHWGOTNDOEV-UHFFFAOYSA-N.

Identity
Molecular formulaC9H4F4O4
Molecular weight252.12 g/mol
IUPAC name4-acetyloxy-2,3,5,6-tetrafluorobenzoic acid
InChIKeyWIGOHWGOTNDOEV-UHFFFAOYSA-N
SMILESCC(=O)OC1=C(C(=C(C(=C1F)F)C(=O)O)F)F

Computed by PubChem (NCBI)