CAS 83789-90-6 is the registry number for 4-Acetoxy-2,3,5,6-tetrafluorobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
4-acetyloxy-2,3,5,6-tetrafluorobenzoic acid (CAS 83789-90-6) is a chemical compound with the molecular formula C9H4F4O4 and a molecular weight of 252.12 g/mol. IUPAC name: 4-acetyloxy-2,3,5,6-tetrafluorobenzoic acid. InChIKey: WIGOHWGOTNDOEV-UHFFFAOYSA-N.
| Molecular formula | C9H4F4O4 |
|---|---|
| Molecular weight | 252.12 g/mol |
| IUPAC name | 4-acetyloxy-2,3,5,6-tetrafluorobenzoic acid |
| InChIKey | WIGOHWGOTNDOEV-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C(=C(C(=C1F)F)C(=O)O)F)F |
Computed by PubChem (NCBI)