CAS 18011-19-3 appears in our catalog under these names: 3-Benzoyl-4H-1,2,4-triazole, 3-Benzoyl-4H-1,2,4-triazole, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
Phenyl(1H-1,2,4-triazol-5-yl)methanone (CAS 18011-19-3) is a chemical compound with the molecular formula C9H7N3O and a molecular weight of 173.17 g/mol. IUPAC name: phenyl(1H-1,2,4-triazol-5-yl)methanone. InChIKey: IPXBPSDPZBUVNK-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | phenyl(1H-1,2,4-triazol-5-yl)methanone |
| InChIKey | IPXBPSDPZBUVNK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=NC=NN2 |
Computed by PubChem (NCBI)