CAS 1801408-17-2 appears in our catalog under these names: 3-Amino-5-carbamoylphenylboronic acid, 98%, 3-Amino-5-carbamoylphenylboronic acid, 98%, 98%, (3-Amino-5-Carbamoylphenyl)boronic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g.
(3-amino-5-carbamoylphenyl)boronic acid (CAS 1801408-17-2) is a chemical compound with the molecular formula C7H9BN2O3 and a molecular weight of 179.97 g/mol. IUPAC name: (3-amino-5-carbamoylphenyl)boronic acid. InChIKey: SGUFPLUNZOZMTQ-UHFFFAOYSA-N.
| Molecular formula | C7H9BN2O3 |
|---|---|
| Molecular weight | 179.97 g/mol |
| IUPAC name | (3-amino-5-carbamoylphenyl)boronic acid |
| InChIKey | SGUFPLUNZOZMTQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)N)C(=O)N)(O)O |
Computed by PubChem (NCBI)