Products 90084-66-5
CAS 90084-66-5 appears in our catalog under these names: 3-Ureidophenylboronic acid, 96%, (3-(Carbamoylamino)phenyl)boronic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5g, 100mg, 2,5g.
[3-(carbamoylamino)phenyl]boronic acid (CAS 90084-66-5) is a chemical compound with the molecular formula C7H9BN2O3 and a molecular weight of 179.97 g/mol. IUPAC name: [3-(carbamoylamino)phenyl]boronic acid. InChIKey: FDZYBPMGFTXHMK-UHFFFAOYSA-N.
| Molecular formula | C7H9BN2O3 |
|---|---|
| Molecular weight | 179.97 g/mol |
| IUPAC name | [3-(carbamoylamino)phenyl]boronic acid |
| InChIKey | FDZYBPMGFTXHMK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)NC(=O)N)(O)O |
Computed by PubChem (NCBI)
Synonyms:
Urea, 1-(m-boronophenyl)-, [3-(carbamoylamino)phenyl]boronic acid, 1-(m-Boronophenyl)urea, m-Ureidobenzeneboronic acid, Benzeneboronic acid, m-ureido-, 4-16-00-01684 (Beilstein Handbook Reference), (3-(carbamoylamino)phenyl)boronic acid, 3-Ureidophenylboronic acid, (3-Ureidophenyl)boronic acid, (3-Ureidophenyl)boronicacid