CAS 18017-22-6 appears in our catalog under these names: Perfluoro-6-methylheptanoic acid sodium, Perfluoro-6-methylheptanoic acid sodium 50 µg/mL in Methanol:Water. Offered by: Dr. Ehrenstorfer. Available pack sizes: 10mg, 1ml.
Sodium 2,2,3,3,4,4,5,5,6,7,7,7-dodecafluoro-6-(trifluoromethyl)heptanoate (CAS 18017-22-6) is a chemical compound with the molecular formula C8F15NaO2 and a molecular weight of 436.05 g/mol. IUPAC name: sodium 2,2,3,3,4,4,5,5,6,7,7,7-dodecafluoro-6-(trifluoromethyl)heptanoate. InChIKey: BPXXAVYRMUUMMP-UHFFFAOYSA-M.
| Molecular formula | C8F15NaO2 |
|---|---|
| Molecular weight | 436.05 g/mol |
| IUPAC name | sodium 2,2,3,3,4,4,5,5,6,7,7,7-dodecafluoro-6-(trifluoromethyl)heptanoate |
| InChIKey | BPXXAVYRMUUMMP-UHFFFAOYSA-M |
| SMILES | C(=O)(C(C(C(C(C(C(F)(F)F)(C(F)(F)F)F)(F)F)(F)F)(F)F)(F)F)[O-].[Na+] |
Computed by PubChem (NCBI)