CAS 335-95-5 appears in our catalog under these names: Sodium perfluorooctanoate, 95%, Sodium perfluorooctanoate, Sodiumperfluorooctanoate, 97%,RG, 97%,RG, Perfluorooctanic acid sodium salt, ROTI®Star, 100 mg, glass. Offered by: Combi-blocks, GLPBio, Chemat, Roth. Available pack sizes: 100g, 5g, 25g, 1g, 100mg.
Sodium 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate (CAS 335-95-5) is a chemical compound with the molecular formula C8F15NaO2 and a molecular weight of 436.05 g/mol. IUPAC name: sodium 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate. InChIKey: LWHQXUODFPPQTL-UHFFFAOYSA-M.
| Molecular formula | C8F15NaO2 |
|---|---|
| Molecular weight | 436.05 g/mol |
| IUPAC name | sodium 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate |
| InChIKey | LWHQXUODFPPQTL-UHFFFAOYSA-M |
| SMILES | C(=O)(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)[O-].[Na+] |
Computed by PubChem (NCBI)