Products 1802181-21-0
CAS 1802181-21-0 is the registry number for 6-(Phenylsulfanyl)-2H-1,3-benzodioxol-5-ol, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
6-phenylsulfanyl-1,3-benzodioxol-5-ol (CAS 1802181-21-0) is a chemical compound with the molecular formula C13H10O3S and a molecular weight of 246.28 g/mol. IUPAC name: 6-phenylsulfanyl-1,3-benzodioxol-5-ol. InChIKey: OMYYYRSBSKZXJM-UHFFFAOYSA-N.
| Molecular formula | C13H10O3S |
|---|---|
| Molecular weight | 246.28 g/mol |
| IUPAC name | 6-phenylsulfanyl-1,3-benzodioxol-5-ol |
| InChIKey | OMYYYRSBSKZXJM-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)O)SC3=CC=CC=C3 |
Computed by PubChem (NCBI)