Products 931114-41-9

CAS 931114-41-9 appears in our catalog under these names: 1,1-Dioxo-2-(hydroxymethyl)naphtho[1,2-b]thiophene, 95%, 2–(Hydroxymethyl)naphtho(1,2–b)thiophene 1,1–dioxide. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 100mg, 10g, 250mg, 1g.

Structural formula: {0} (CAS {1})

(1,1-dioxobenzo[g][1]benzothiol-2-yl)methanol (CAS 931114-41-9) is a chemical compound with the molecular formula C13H10O3S and a molecular weight of 246.28 g/mol. IUPAC name: (1,1-dioxobenzo[g][1]benzothiol-2-yl)methanol. InChIKey: NEUKNEIRLXPDLI-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10O3S
Molecular weight246.28 g/mol
IUPAC name(1,1-dioxobenzo[g][1]benzothiol-2-yl)methanol
InChIKeyNEUKNEIRLXPDLI-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C=CC3=C2S(=O)(=O)C(=C3)CO

Computed by PubChem (NCBI)