CAS 1803033-59-1 is the registry number for 5-((tert-Butoxycarbonyl)amino)cyclohex-1-en-1-yl trifluoromethanesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[5-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexen-1-yl] trifluoromethanesulfonate (CAS 1803033-59-1) is a chemical compound with the molecular formula C12H18F3NO5S and a molecular weight of 345.34 g/mol. IUPAC name: [5-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexen-1-yl] trifluoromethanesulfonate. InChIKey: XGVCNVDOXAGSBO-UHFFFAOYSA-N.
| Molecular formula | C12H18F3NO5S |
|---|---|
| Molecular weight | 345.34 g/mol |
| IUPAC name | [5-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexen-1-yl] trifluoromethanesulfonate |
| InChIKey | XGVCNVDOXAGSBO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCC=C(C1)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)