CAS 849069-49-4 is the registry number for 4-((tert-Butoxycarbonyl)amino)cyclohex-1-en-1-yl trifluoromethanesulfonate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexen-1-yl] trifluoromethanesulfonate (CAS 849069-49-4) is a chemical compound with the molecular formula C12H18F3NO5S and a molecular weight of 345.34 g/mol. IUPAC name: [4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexen-1-yl] trifluoromethanesulfonate. InChIKey: SEHNWAWVQGNEKM-UHFFFAOYSA-N.
| Molecular formula | C12H18F3NO5S |
|---|---|
| Molecular weight | 345.34 g/mol |
| IUPAC name | [4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexen-1-yl] trifluoromethanesulfonate |
| InChIKey | SEHNWAWVQGNEKM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCC(=CC1)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)