Products 1803093-47-1
CAS 1803093-47-1 is the registry number for 4-Bromo-2-(2-chloroethyl)benzoyl Chloride, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-bromo-2-(2-chloroethyl)benzoyl chloride (CAS 1803093-47-1) is a chemical compound with the molecular formula C9H7BrCl2O and a molecular weight of 281.96 g/mol. IUPAC name: 4-bromo-2-(2-chloroethyl)benzoyl chloride. InChIKey: RENZIMXJMNOMFO-UHFFFAOYSA-N.
| Molecular formula | C9H7BrCl2O |
|---|---|
| Molecular weight | 281.96 g/mol |
| IUPAC name | 4-bromo-2-(2-chloroethyl)benzoyl chloride |
| InChIKey | RENZIMXJMNOMFO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)CCCl)C(=O)Cl |
Computed by PubChem (NCBI)