Products 1803241-00-0
CAS 1803241-00-0 is the registry number for alpha-(Methoxyimino)-2-furanacetyl-d3 Chloride. Offered by: TRC. Available pack sizes: 25mg.
(2Z)-2-(furan-2-yl)-2-(trideuteriomethoxyimino)acetyl chloride (CAS 1803241-00-0) is a chemical compound with the molecular formula C7H6ClNO3 and a molecular weight of 190.60 g/mol. IUPAC name: (2Z)-2-(furan-2-yl)-2-(trideuteriomethoxyimino)acetyl chloride. InChIKey: HCJIHHSBMCGTGF-OKSOJQMDSA-N.
| Molecular formula | C7H6ClNO3 |
|---|---|
| Molecular weight | 190.60 g/mol |
| IUPAC name | (2Z)-2-(furan-2-yl)-2-(trideuteriomethoxyimino)acetyl chloride |
| InChIKey | HCJIHHSBMCGTGF-OKSOJQMDSA-N |
| SMILES | [2H]C([2H])([2H])O/N=C(/C1=CC=CO1)\C(=O)Cl |
Computed by PubChem (NCBI)