CAS 59176-08-8 appears in our catalog under these names: (Z)-2-(furan-2-yl)-2-(methoxyimino)acetyl chloride, Cefuroxime Impurity 27, α-(Methoxyimino)-2-furanacetyl Chloride, >95% (GC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g, 2,5g, 250mg.
(2Z)-2-(furan-2-yl)-2-methoxyiminoacetyl chloride (CAS 59176-08-8) is a chemical compound with the molecular formula C7H6ClNO3 and a molecular weight of 187.58 g/mol. IUPAC name: (2Z)-2-(furan-2-yl)-2-methoxyiminoacetyl chloride. InChIKey: HCJIHHSBMCGTGF-TWGQIWQCSA-N.
| Molecular formula | C7H6ClNO3 |
|---|---|
| Molecular weight | 187.58 g/mol |
| IUPAC name | (2Z)-2-(furan-2-yl)-2-methoxyiminoacetyl chloride |
| InChIKey | HCJIHHSBMCGTGF-TWGQIWQCSA-N |
| SMILES | CO/N=C(/C1=CC=CO1)\C(=O)Cl |
Computed by PubChem (NCBI)