Products 1803270-60-1
CAS 1803270-60-1 appears in our catalog under these names: Frunexian, Frunexian, 97.16%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 50 mg, 25 mg, 5 mg, 10 mg.
(2S,3R)-3-[(2-amino-4-pyridinyl)methyl]-1-[[(1R)-1-cyclohexylethyl]carbamoyl]-4-oxoazetidine-2-carboxylic acid (CAS 1803270-60-1) is a chemical compound with the molecular formula C19H26N4O4 and a molecular weight of 374.4 g/mol. IUPAC name: (2S,3R)-3-[(2-amino-4-pyridinyl)methyl]-1-[[(1R)-1-cyclohexylethyl]carbamoyl]-4-oxoazetidine-2-carboxylic acid. InChIKey: NYPSZHLKEMYZKK-XFJVYGCCSA-N.
| Molecular formula | C19H26N4O4 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | (2S,3R)-3-[(2-amino-4-pyridinyl)methyl]-1-[[(1R)-1-cyclohexylethyl]carbamoyl]-4-oxoazetidine-2-carboxylic acid |
| InChIKey | NYPSZHLKEMYZKK-XFJVYGCCSA-N |
| SMILES | C[C@H](C1CCCCC1)NC(=O)N2[C@@H]([C@H](C2=O)CC3=CC(=NC=C3)N)C(=O)O |
Computed by PubChem (NCBI)