CAS 94149-28-7 appears in our catalog under these names: H–Lys–Ala–AMC, H-Lys-Ala-AMC hydrochloride salt, Lys-Ala-AMC. Offered by: GLPBio, Biosynth. Available pack sizes: 250mg, 50mg, 500mg, 5mg, 1000mg.
(2S)-2,6-diamino-N-[(2S)-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxopropan-2-yl]hexanamide (CAS 94149-28-7) is a chemical compound with the molecular formula C19H26N4O4 and a molecular weight of 374.4 g/mol. IUPAC name: (2S)-2,6-diamino-N-[(2S)-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxopropan-2-yl]hexanamide. InChIKey: BEIXTDYXKGFYLC-WFASDCNBSA-N.
| Molecular formula | C19H26N4O4 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | (2S)-2,6-diamino-N-[(2S)-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxopropan-2-yl]hexanamide |
| InChIKey | BEIXTDYXKGFYLC-WFASDCNBSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@H](C)NC(=O)[C@H](CCCCN)N |
Computed by PubChem (NCBI)