Products 1803272-57-2
CAS 1803272-57-2 is the registry number for Methyl 2-((tert-butoxycarbonyl)(methyl)amino)isonicotinate, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
Methyl 2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyridine-4-carboxylate (CAS 1803272-57-2) is a chemical compound with the molecular formula C13H18N2O4 and a molecular weight of 266.29 g/mol. IUPAC name: methyl 2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyridine-4-carboxylate. InChIKey: HTMFEPXINZZLPZ-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O4 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | methyl 2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyridine-4-carboxylate |
| InChIKey | HTMFEPXINZZLPZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C1=NC=CC(=C1)C(=O)OC |
Computed by PubChem (NCBI)