CAS 1803561-29-6 is the registry number for (5-(2-Methylpropyl)-1,3,4-oxadiazol-2-yl)methanamine, oxalic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[5-(2-methylpropyl)-1,3,4-oxadiazol-2-yl]methanamine;oxalic acid (CAS 1803561-29-6) is a chemical compound with the molecular formula C9H15N3O5 and a molecular weight of 245.23 g/mol. IUPAC name: [5-(2-methylpropyl)-1,3,4-oxadiazol-2-yl]methanamine;oxalic acid. InChIKey: SZLPVBUTGQRBNM-UHFFFAOYSA-N.
| Molecular formula | C9H15N3O5 |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | [5-(2-methylpropyl)-1,3,4-oxadiazol-2-yl]methanamine;oxalic acid |
| InChIKey | SZLPVBUTGQRBNM-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=NN=C(O1)CN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)