Products 57350-36-4
CAS 57350-36-4 is the registry number for Antibiotic U 44590. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-1,3,5-triazinane-2,4-dione (CAS 57350-36-4) is a chemical compound with the molecular formula C9H15N3O5 and a molecular weight of 245.23 g/mol. IUPAC name: 1-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-1,3,5-triazinane-2,4-dione. InChIKey: RFYOMFHIKWGPEC-XVMARJQXSA-N.
| Molecular formula | C9H15N3O5 |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | 1-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-1,3,5-triazinane-2,4-dione |
| InChIKey | RFYOMFHIKWGPEC-XVMARJQXSA-N |
| SMILES | CN1CN(C(=O)NC1=O)[C@@H]2C[C@@H]([C@H](O2)CO)O |
Computed by PubChem (NCBI)