CAS 1803567-42-1 appears in our catalog under these names: 6-Bromo-2H-benzo(e)(1,2)thiazin-3(4H)-one 1,1-dioxide, 95%, 6-Bromo-3,4-dihydro-2H-1,2-benzothiazine-1,1,3-trione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6-bromo-1,1-dioxo-4H-1lambda6,2-benzothiazin-3-one (CAS 1803567-42-1) is a chemical compound with the molecular formula C8H6BrNO3S and a molecular weight of 276.11 g/mol. IUPAC name: 6-bromo-1,1-dioxo-4H-1lambda6,2-benzothiazin-3-one. InChIKey: ZUDCVPVAVABRMH-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO3S |
|---|---|
| Molecular weight | 276.11 g/mol |
| IUPAC name | 6-bromo-1,1-dioxo-4H-1lambda6,2-benzothiazin-3-one |
| InChIKey | ZUDCVPVAVABRMH-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)Br)S(=O)(=O)NC1=O |
Computed by PubChem (NCBI)