CAS 1823553-64-5 appears in our catalog under these names: 7-​Bromo-​2,​3-​dihydro-​4H-​1,​3-​benzothiazin-​4-​one 1,​1-​dioxide, 7-Bromo-2,3-dihydro-4H-benzo[e][1,3]thiazin-4-one 1,1-dioxide, 95%, 95%, 7-Bromo-2,3-dihydro-4H-benzo[e][1,3]thiazin-4-one 1,1-dioxide, 95%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g.
7-bromo-1,1-dioxo-2,3-dihydro-1lambda6,3-benzothiazin-4-one (CAS 1823553-64-5) is a chemical compound with the molecular formula C8H6BrNO3S and a molecular weight of 276.11 g/mol. IUPAC name: 7-bromo-1,1-dioxo-2,3-dihydro-1lambda6,3-benzothiazin-4-one. InChIKey: JXXRRXKMTXVLER-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO3S |
|---|---|
| Molecular weight | 276.11 g/mol |
| IUPAC name | 7-bromo-1,1-dioxo-2,3-dihydro-1lambda6,3-benzothiazin-4-one |
| InChIKey | JXXRRXKMTXVLER-UHFFFAOYSA-N |
| SMILES | C1NC(=O)C2=C(S1(=O)=O)C=C(C=C2)Br |
Computed by PubChem (NCBI)