CAS 1803570-04-8 appears in our catalog under these names: 4,4,4-Trifluoro-3-(1-methyl-1H-imidazol-2-yl)butanoic acid hydrochloride, 95%, 4,4,4-Trifluoro-3-(1-methyl-1H-imidazol-2-yl)butanoic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4,4,4-trifluoro-3-(1-methylimidazol-2-yl)butanoic acid;hydrochloride (CAS 1803570-04-8) is a chemical compound with the molecular formula C8H10ClF3N2O2 and a molecular weight of 258.62 g/mol. IUPAC name: 4,4,4-trifluoro-3-(1-methylimidazol-2-yl)butanoic acid;hydrochloride. InChIKey: FWRNZNNRKRWCDE-UHFFFAOYSA-N.
| Molecular formula | C8H10ClF3N2O2 |
|---|---|
| Molecular weight | 258.62 g/mol |
| IUPAC name | 4,4,4-trifluoro-3-(1-methylimidazol-2-yl)butanoic acid;hydrochloride |
| InChIKey | FWRNZNNRKRWCDE-UHFFFAOYSA-N |
| SMILES | CN1C=CN=C1C(CC(=O)O)C(F)(F)F.Cl |
Computed by PubChem (NCBI)