CAS 1820703-40-9 is the registry number for Methyl 2-amino-3,3,3-trifluoro-2-(1H-pyrrol-2-yl)propanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Methyl 2-amino-3,3,3-trifluoro-2-(1H-pyrrol-2-yl)propanoate;hydrochloride (CAS 1820703-40-9) is a chemical compound with the molecular formula C8H10ClF3N2O2 and a molecular weight of 258.62 g/mol. IUPAC name: methyl 2-amino-3,3,3-trifluoro-2-(1H-pyrrol-2-yl)propanoate;hydrochloride. InChIKey: SWNAHAUWIIPEBB-UHFFFAOYSA-N.
| Molecular formula | C8H10ClF3N2O2 |
|---|---|
| Molecular weight | 258.62 g/mol |
| IUPAC name | methyl 2-amino-3,3,3-trifluoro-2-(1H-pyrrol-2-yl)propanoate;hydrochloride |
| InChIKey | SWNAHAUWIIPEBB-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC=CN1)(C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)