Products 1803570-22-0
CAS 1803570-22-0 appears in our catalog under these names: 3-Chloro-5-methanesulfonylpyridin-2-amine, 95%, 3-Chloro-5-methanesulfonylpyridin-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-chloro-5-methylsulfonylpyridin-2-amine (CAS 1803570-22-0) is a chemical compound with the molecular formula C6H7ClN2O2S and a molecular weight of 206.65 g/mol. IUPAC name: 3-chloro-5-methylsulfonylpyridin-2-amine. InChIKey: XEKAQPDCDRNPDA-UHFFFAOYSA-N.
| Molecular formula | C6H7ClN2O2S |
|---|---|
| Molecular weight | 206.65 g/mol |
| IUPAC name | 3-chloro-5-methylsulfonylpyridin-2-amine |
| InChIKey | XEKAQPDCDRNPDA-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(N=C1)N)Cl |
Computed by PubChem (NCBI)