Products 1803570-66-2

CAS 1803570-66-2 appears in our catalog under these names: (1-Fluorocyclopentyl)methanesulfonyl chloride, 95%, (1-Fluorocyclopentyl)methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

(1-fluorocyclopentyl)methanesulfonyl chloride (CAS 1803570-66-2) is a chemical compound with the molecular formula C6H10ClFO2S and a molecular weight of 200.66 g/mol. IUPAC name: (1-fluorocyclopentyl)methanesulfonyl chloride. InChIKey: ANZUFNQVFPFKQD-UHFFFAOYSA-N.

Identity
Molecular formulaC6H10ClFO2S
Molecular weight200.66 g/mol
IUPAC name(1-fluorocyclopentyl)methanesulfonyl chloride
InChIKeyANZUFNQVFPFKQD-UHFFFAOYSA-N
SMILESC1CCC(C1)(CS(=O)(=O)Cl)F

Computed by PubChem (NCBI)