CAS 2091598-16-0 is the registry number for Rel-(1R,2S)-2-fluorocyclohexane-1-sulfonyl chloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Cis-(1S,2R)-2-fluorocyclohexane-1-sulfonyl chloride (CAS 2091598-16-0) is a chemical compound with the molecular formula C6H10ClFO2S and a molecular weight of 200.66 g/mol. IUPAC name: cis-(1S,2R)-2-fluorocyclohexane-1-sulfonyl chloride. InChIKey: IAGUHAITTUUZQV-RITPCOANSA-N.
| Molecular formula | C6H10ClFO2S |
|---|---|
| Molecular weight | 200.66 g/mol |
| IUPAC name | cis-(1S,2R)-2-fluorocyclohexane-1-sulfonyl chloride |
| InChIKey | IAGUHAITTUUZQV-RITPCOANSA-N |
| SMILES | C1CC[C@@H]([C@@H](C1)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)