Products 1803571-58-5
CAS 1803571-58-5 is the registry number for 4'-Fluoro-1',2'-dihydrospiro(cyclobutane-1,3'-indole) hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-fluorospiro[1,2-dihydroindole-3,1'-cyclobutane];hydrochloride (CAS 1803571-58-5) is a chemical compound with the molecular formula C11H13ClFN and a molecular weight of 213.68 g/mol. IUPAC name: 4-fluorospiro[1,2-dihydroindole-3,1'-cyclobutane];hydrochloride. InChIKey: XUWPEZQYDMKRAN-UHFFFAOYSA-N.
| Molecular formula | C11H13ClFN |
|---|---|
| Molecular weight | 213.68 g/mol |
| IUPAC name | 4-fluorospiro[1,2-dihydroindole-3,1'-cyclobutane];hydrochloride |
| InChIKey | XUWPEZQYDMKRAN-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)CNC3=C2C(=CC=C3)F.Cl |
Computed by PubChem (NCBI)