Products 1803581-04-5
CAS 1803581-04-5 is the registry number for tert-Butyl 4-(3-ethoxy-4-nitrophenyl)piperazine-1-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
Tert-butyl 4-(3-ethoxy-4-nitrophenyl)piperazine-1-carboxylate (CAS 1803581-04-5) is a chemical compound with the molecular formula C17H25N3O5 and a molecular weight of 351.4 g/mol. IUPAC name: tert-butyl 4-(3-ethoxy-4-nitrophenyl)piperazine-1-carboxylate. InChIKey: YUORLDJFQVYMDQ-UHFFFAOYSA-N.
| Molecular formula | C17H25N3O5 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | tert-butyl 4-(3-ethoxy-4-nitrophenyl)piperazine-1-carboxylate |
| InChIKey | YUORLDJFQVYMDQ-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)N2CCN(CC2)C(=O)OC(C)(C)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)