CAS 76264-07-8 appears in our catalog under these names: Z-Ala-lys-oh, 95%, Z–Ala–Lys–OH. Offered by: Combi-blocks, GLPBio. Available pack sizes: 500mg, 250mg, 1g, 5g.
(2S)-6-amino-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]hexanoic acid (CAS 76264-07-8) is a chemical compound with the molecular formula C17H25N3O5 and a molecular weight of 351.4 g/mol. IUPAC name: (2S)-6-amino-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]hexanoic acid. InChIKey: RQMDMYNAXPFMCC-JSGCOSHPSA-N.
| Molecular formula | C17H25N3O5 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | (2S)-6-amino-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]hexanoic acid |
| InChIKey | RQMDMYNAXPFMCC-JSGCOSHPSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](CCCCN)C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)