CAS 1803581-25-0 appears in our catalog under these names: ((2,3-Dichlorophenyl)methyl)hydrazine dihydrochloride, 97+%, ((2,3-Dichlorophenyl)methyl)hydrazine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(2,3-dichlorophenyl)methylhydrazine;dihydrochloride (CAS 1803581-25-0) is a chemical compound with the molecular formula C7H10Cl4N2 and a molecular weight of 264.0 g/mol. IUPAC name: (2,3-dichlorophenyl)methylhydrazine;dihydrochloride. InChIKey: FCGYYSWCTICTPJ-UHFFFAOYSA-N.
| Molecular formula | C7H10Cl4N2 |
|---|---|
| Molecular weight | 264.0 g/mol |
| IUPAC name | (2,3-dichlorophenyl)methylhydrazine;dihydrochloride |
| InChIKey | FCGYYSWCTICTPJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)CNN.Cl.Cl |
Computed by PubChem (NCBI)