CAS 2044707-08-4 is the registry number for (3,4-Dichlorobenzyl)hydrazine dihydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
(3,4-dichlorophenyl)methylhydrazine;dihydrochloride (CAS 2044707-08-4) is a chemical compound with the molecular formula C7H10Cl4N2 and a molecular weight of 264.0 g/mol. IUPAC name: (3,4-dichlorophenyl)methylhydrazine;dihydrochloride. InChIKey: XCXDMKYLGBYRNK-UHFFFAOYSA-N.
| Molecular formula | C7H10Cl4N2 |
|---|---|
| Molecular weight | 264.0 g/mol |
| IUPAC name | (3,4-dichlorophenyl)methylhydrazine;dihydrochloride |
| InChIKey | XCXDMKYLGBYRNK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CNN)Cl)Cl.Cl.Cl |
Computed by PubChem (NCBI)