CAS 1803581-26-1 appears in our catalog under these names: 2-(4-Chlorophenyl)-1,3-thiazole-4-sulfonamide, 95%, 2-(4-Chlorophenyl)-1,3-thiazole-4-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(4-chlorophenyl)-1,3-thiazole-4-sulfonamide (CAS 1803581-26-1) is a chemical compound with the molecular formula C9H7ClN2O2S2 and a molecular weight of 274.8 g/mol. IUPAC name: 2-(4-chlorophenyl)-1,3-thiazole-4-sulfonamide. InChIKey: LAQPGMYXFHHLLF-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2S2 |
|---|---|
| Molecular weight | 274.8 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-1,3-thiazole-4-sulfonamide |
| InChIKey | LAQPGMYXFHHLLF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CS2)S(=O)(=O)N)Cl |
Computed by PubChem (NCBI)