CAS 99067-53-5 is the registry number for 4-Chloro-N-(thiazol-2-yl)benzenesulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-N-(1,3-thiazol-2-yl)benzenesulfonamide (CAS 99067-53-5) is a chemical compound with the molecular formula C9H7ClN2O2S2 and a molecular weight of 274.8 g/mol. IUPAC name: 4-chloro-N-(1,3-thiazol-2-yl)benzenesulfonamide. InChIKey: YBXYWOXGCPZQIZ-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2S2 |
|---|---|
| Molecular weight | 274.8 g/mol |
| IUPAC name | 4-chloro-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| InChIKey | YBXYWOXGCPZQIZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)NC2=NC=CS2)Cl |
Computed by PubChem (NCBI)