Products 1803581-41-0

CAS 1803581-41-0 is the registry number for tert-Butyl 4-(2-fluorophenyl)-2-methylpiperazine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl 4-(2-fluorophenyl)-2-methylpiperazine-1-carboxylate (CAS 1803581-41-0) is a chemical compound with the molecular formula C16H23FN2O2 and a molecular weight of 294.36 g/mol. IUPAC name: tert-butyl 4-(2-fluorophenyl)-2-methylpiperazine-1-carboxylate. InChIKey: ZZFJDIPACBIKFF-UHFFFAOYSA-N.

Identity
Molecular formulaC16H23FN2O2
Molecular weight294.36 g/mol
IUPAC nametert-butyl 4-(2-fluorophenyl)-2-methylpiperazine-1-carboxylate
InChIKeyZZFJDIPACBIKFF-UHFFFAOYSA-N
SMILESCC1CN(CCN1C(=O)OC(C)(C)C)C2=CC=CC=C2F

Computed by PubChem (NCBI)