CAS 1803581-80-7 appears in our catalog under these names: 2-(4-(Trifluoromethyl)pyridin-2-yl)acetic acid, sodium salt, 95+%, Sodium 2-(4-(trifluoromethyl)pyridin-2-yl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Sodium 2-[4-(trifluoromethyl)-2-pyridinyl]acetate (CAS 1803581-80-7) is a chemical compound with the molecular formula C8H5F3NNaO2 and a molecular weight of 227.12 g/mol. IUPAC name: sodium 2-[4-(trifluoromethyl)-2-pyridinyl]acetate. InChIKey: VSUBKVJBNDGWHT-UHFFFAOYSA-M.
| Molecular formula | C8H5F3NNaO2 |
|---|---|
| Molecular weight | 227.12 g/mol |
| IUPAC name | sodium 2-[4-(trifluoromethyl)-2-pyridinyl]acetate |
| InChIKey | VSUBKVJBNDGWHT-UHFFFAOYSA-M |
| SMILES | C1=CN=C(C=C1C(F)(F)F)CC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)