CAS 2732751-11-8 is the registry number for Sodium 2-(3-(trifluoromethyl)pyridin-2-yl)acetate, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
Sodium 2-[3-(trifluoromethyl)-2-pyridinyl]acetate (CAS 2732751-11-8) is a chemical compound with the molecular formula C8H5F3NNaO2 and a molecular weight of 227.12 g/mol. IUPAC name: sodium 2-[3-(trifluoromethyl)-2-pyridinyl]acetate. InChIKey: YQUQPFRMRUETPN-UHFFFAOYSA-M.
| Molecular formula | C8H5F3NNaO2 |
|---|---|
| Molecular weight | 227.12 g/mol |
| IUPAC name | sodium 2-[3-(trifluoromethyl)-2-pyridinyl]acetate |
| InChIKey | YQUQPFRMRUETPN-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(N=C1)CC(=O)[O-])C(F)(F)F.[Na+] |
Computed by PubChem (NCBI)