CAS 1803582-91-3 appears in our catalog under these names: 6-Phenyl-2,3-dihydro-1H-inden-1-amine hydrochloride, 95%, 6-Phenyl-2,3-dihydro-1H-inden-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6-phenyl-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 1803582-91-3) is a chemical compound with the molecular formula C15H16ClN and a molecular weight of 245.74 g/mol. IUPAC name: 6-phenyl-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: IHLRXCAZGKPWRZ-UHFFFAOYSA-N.
| Molecular formula | C15H16ClN |
|---|---|
| Molecular weight | 245.74 g/mol |
| IUPAC name | 6-phenyl-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | IHLRXCAZGKPWRZ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1N)C=C(C=C2)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)