CAS 85741-15-7 appears in our catalog under these names: 3-Phenyl-1,2,3,4-tetrahydroisoquinoline hydrochloride, 95%, 3-Phenyl-1,2,3,4-tetrahydroisoquinoline hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-phenyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 85741-15-7) is a chemical compound with the molecular formula C15H16ClN and a molecular weight of 245.74 g/mol. IUPAC name: 3-phenyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: XSOBGRJRYZIFLK-UHFFFAOYSA-N.
| Molecular formula | C15H16ClN |
|---|---|
| Molecular weight | 245.74 g/mol |
| IUPAC name | 3-phenyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | XSOBGRJRYZIFLK-UHFFFAOYSA-N |
| SMILES | C1C(NCC2=CC=CC=C21)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)