CAS 1803583-03-0 appears in our catalog under these names: Benzyl 4-amino-6-(dimethylamino)-1,3,5-triazine-2-carboxylate, 95%, Benzyl 4-amino-6-(dimethylamino)-1,3,5-triazine-2-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Benzyl 4-amino-6-(dimethylamino)-1,3,5-triazine-2-carboxylate (CAS 1803583-03-0) is a chemical compound with the molecular formula C13H15N5O2 and a molecular weight of 273.29 g/mol. IUPAC name: benzyl 4-amino-6-(dimethylamino)-1,3,5-triazine-2-carboxylate. InChIKey: TZHLYLOFGUJSEJ-UHFFFAOYSA-N.
| Molecular formula | C13H15N5O2 |
|---|---|
| Molecular weight | 273.29 g/mol |
| IUPAC name | benzyl 4-amino-6-(dimethylamino)-1,3,5-triazine-2-carboxylate |
| InChIKey | TZHLYLOFGUJSEJ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC(=NC(=N1)N)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)