CAS 2925095-87-8 is the registry number for CRBN ligand-563. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[1-(2-aminoethyl)indazol-5-yl]-1,3-diazinane-2,4-dione (CAS 2925095-87-8) is a chemical compound with the molecular formula C13H15N5O2 and a molecular weight of 273.29 g/mol. IUPAC name: 1-[1-(2-aminoethyl)indazol-5-yl]-1,3-diazinane-2,4-dione. InChIKey: LHEPBVMTLOBZFM-UHFFFAOYSA-N.
| Molecular formula | C13H15N5O2 |
|---|---|
| Molecular weight | 273.29 g/mol |
| IUPAC name | 1-[1-(2-aminoethyl)indazol-5-yl]-1,3-diazinane-2,4-dione |
| InChIKey | LHEPBVMTLOBZFM-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CC3=C(C=C2)N(N=C3)CCN |
Computed by PubChem (NCBI)